CAS 158871-28-4: 4,5-BIS(2-CYANOETHYLTHIO)-1,3-DITHIOL-2-ONE
Description:4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-one is a chemical compound characterized by its unique structure, which includes two cyanoethylthio groups attached to a dithiolone core. This compound is notable for its potential applications in organic synthesis and materials science, particularly in the development of polymers and as a building block in various chemical reactions. The presence of cyano groups contributes to its reactivity, making it useful in nucleophilic substitution reactions. Additionally, the dithiolone moiety can participate in redox reactions, enhancing its utility in various chemical processes. The compound is typically handled with care due to its potential toxicity and reactivity, and it may require specific storage conditions to maintain stability. As with many sulfur-containing compounds, it may exhibit distinct odor and color characteristics, which can vary based on concentration and environmental conditions. Overall, 4,5-bis(2-cyanoethylthio)-1,3-dithiol-2-one is a versatile compound with significant implications in synthetic chemistry.
Formula:C9H8N2OS4
InChI:InChI=1/C9H8N2OS4/c10-3-1-5-13-7-8(14-6-2-4-11)16-9(12)15-7/h1-2,5-6H2
- Synonyms:
- 4,5-Bis(2'-Cyanoethylthio)1-3-Dithiol-2-One
- 4,5-Bis(2'-Cyanoethylthio)-1,3-Dithiole-2-One
- Rarechem Ar Pa 0056
- 4,5-Bis(2-Cyanoethylthio)-1,3-Dithiol-2-
- 4,5-Bis(2'-Cyanoethylthio)-1,3-Dithiole-2-One 97%
- 3,3'-[(2-Oxo-1,3-Dithiole-4,5-Diyl)Disulfanediyl]Dipropanenitrile
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-one REF: 3B-B2233CAS: 158871-28-4 | >98.0%(HPLC)(N) | 559.00 € | Thu 20 Mar 25 |
![]() | Propanenitrile, 3,3'-[(2-oxo-1,3-dithiole-4,5-diyl)bis(thio)]bis- REF: IN-DA001QZ0CAS: 158871-28-4 | 98.0% | To inquire | Thu 27 Mar 25 |
![]() | 4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-one REF: 3D-FB61921CAS: 158871-28-4 | Min. 95% | - - - | Discontinued product |

4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-one
Ref: 3B-B2233
1g | 559.00 € |

Propanenitrile, 3,3'-[(2-oxo-1,3-dithiole-4,5-diyl)bis(thio)]bis-
Ref: IN-DA001QZ0
Undefined size | To inquire |

4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-one
Ref: 3D-FB61921
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |