![Boronic acid, [1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl]-](https://static.cymitquimica.com/cas-image/70182-boronic-acid-1-11-dimethylethyl-dimethylsilyl-1h-indol-3-yl.png)
CAS 159590-02-0: Boronic acid, [1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl]-
Description:Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic moiety. The specific compound you mentioned, 1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl boronic acid, features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity with various electrophiles due to the presence of the boronic acid functional group. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and in the field of materials science. Additionally, the presence of the dimethylsilyl and tert-butyl groups can influence the compound's stability, sterics, and electronic properties, which may affect its reactivity and interactions in chemical reactions.
Formula:C14H22BNO2Si
InChI:InChI=1S/C14H22BNO2Si/c1-14(2,3)19(4,5)16-10-12(15(17)18)11-8-6-7-9-13(11)16/h6-10,17-18H,1-5H3
InChI key:InChIKey=GSNHHLNDEKIFIZ-UHFFFAOYSA-N
SMILES:OB(O)C1=CN(C=2C=CC=CC12)[Si](C)(C)C(C)(C)C
- Synonyms:
- (1-(tert-Butyldimethylsilyl)-1H-indol-3-yl)boronic acid
- (1-(tert-Butyldimethylsilyl)-1H-indol-3-yl)boronicacid
- (1-[Tert-Butyl(Dimethyl)Silyl]-1H-Indol-3-Yl)Boronic Acid
- Akos Brn-0347
- Boronic acid, [1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl]-
- Chembrdg-Bb 4014475
- [1-(tert-Butyldimethylsilanyl)-1H-indol-3-yl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Boronic acid, [1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl]- (9CI) REF: IN-DA001R74CAS: 159590-02-0 | - - - | To inquire | Thu 27 Mar 25 |
 | 1-(tert-Butyldimethylsilyl)-1H-indole-3-boronic acid REF: 54-OR360224CAS: 159590-02-0 | - - - | To inquire | Fri 28 Mar 25 |
 | {1-[tert-butyl(dimethyl)silyl]-1H-indol-3-yl}boronic acid REF: 10-F309412CAS: 159590-02-0 | 95.0% | - - - | Discontinued product |
 | 1-(tert-Butyldimethylsilyl)-1H-indole-3-boronic acid REF: 3D-JGA59002CAS: 159590-02-0 | Min. 95% | - - - | Discontinued product |
![Boronic acid, [1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl]- (9CI)](https://static.cymitquimica.com/products/IN/thumb/DA001R74.jpg)
Boronic acid, [1-[(1,1-dimethylethyl)dimethylsilyl]-1H-indol-3-yl]- (9CI)
Ref: IN-DA001R74
| Undefined size | To inquire |
Ref: 54-OR360224
| Undefined size | To inquire |
![{1-[tert-butyl(dimethyl)silyl]-1H-indol-3-yl}boronic acid](https://static.cymitquimica.com/products/10/thumb/F309412.jpg)
{1-[tert-butyl(dimethyl)silyl]-1H-indol-3-yl}boronic acid
Ref: 10-F309412
| 1g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
1-(tert-Butyldimethylsilyl)-1H-indole-3-boronic acid
Ref: 3D-JGA59002
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
