CAS 159858-33-0: L-Valyl-L-citrulline

Description:L-Valyl-L-citrulline is a dipeptide composed of the amino acids valine and citrulline. It is characterized by its structure, which includes a peptide bond linking the carboxyl group of valine to the amino group of citrulline. This compound is known for its potential benefits in enhancing athletic performance and promoting muscle recovery, as citrulline is involved in the urea cycle and can help improve blood flow and reduce fatigue. L-Valyl-L-citrulline is soluble in water, making it suitable for various formulations, including dietary supplements. Its stability and bioavailability are important factors for its effectiveness in physiological applications. Additionally, it may exhibit antioxidant properties, contributing to overall health benefits. As with many peptides, the specific effects and mechanisms of action can vary based on dosage and individual metabolism. Overall, L-Valyl-L-citrulline represents a valuable compound in the field of sports nutrition and health supplementation.

Formula:C₁₁H₂₂N₄O₄

InChI:InChI=1S/C11H22N4O4/c1-6(2)8(12)9(16)15-7(10(17)18)4-3-5-14-11(13)19/h6-8H,3-5,12H2,1-2H3,(H,15,16)(H,17,18)(H3,13,14,19)/t7-,8-/m0/s1

InChI key:InChIKey=AGGWFDNPHKLBBV-YUMQZZPRSA-N

SMILES:O=C(N)NCCCC(NC(=O)C(N)C(C)C)C(=O)O

Synonyms:
L-Ornithine, L-valyl-N5-(aminocarbonyl)-
Val-Cit
L-Valyl-N5-(aminocarbonyl)-L-ornithine
L-Valyl-L-citrulline
L-Ornithine, N5-(aminocarbonyl)-N2-L-valyl-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Val-Cit REF: IN-DA01JOTUCAS: 159858-33-0	95%	To inquire	Thu 27 Mar 25
(S)-2-((S)-2-AMINO-3-METHYLBUTANAMIDO)-5-UREIDOPENTANOIC ACID REF: 10-F835646CAS: 159858-33-0	95%	376.00 €~2,021.00 €	Tue 01 Apr 25
Val-Cit REF: TM-T18868CAS: 159858-33-0	99.74%	64.00 €~2,172.00 €	Thu 03 Apr 25
Val-Cit REF: 3D-JGA85833CAS: 159858-33-0	Min. 95%	- - -	Discontinued product