CAS 159922-68-6: 4-Methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-β-D-galactopyranoside
Description:4-Methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-β-D-galactopyranoside, with CAS number 159922-68-6, is a complex glycoside compound characterized by its structural features that include a methoxyphenyl group and multiple phenylmethyl substituents. This compound is part of a class of glycosides that typically exhibit various biological activities, including potential antioxidant and anti-inflammatory properties. The presence of the β-D-galactopyranoside moiety suggests that it may participate in carbohydrate-related interactions, which could influence its solubility and reactivity. The methylethylidene group adds to its structural complexity, potentially affecting its stability and interaction with biological targets. Such compounds are often studied for their pharmacological potential, and their synthesis may involve specific glycosylation reactions. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential applications in medicinal chemistry and biochemistry.
Formula:C30H34O7
InChI:InChI=1S/C30H34O7/c1-30(2)36-26-25(20-32-18-21-10-6-4-7-11-21)35-29(34-24-16-14-23(31-3)15-17-24)28(27(26)37-30)33-19-22-12-8-5-9-13-22/h4-17,25-29H,18-20H2,1-3H3/t25-,26+,27+,28-,29-/m1/s1
InChI key:InChIKey=PGZOKVMOUQDWPV-JYJZCUDQSA-N
SMILES:O(C1=CC=C(OC2OC(COCC=3C=CC=CC3)C4OC(OC4C2OCC=5C=CC=CC5)(C)C)C=C1)C
- Synonyms:
- 4-Methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-β-<span class="text-smallcaps">D</span>-galactopyranoside
- 4-Methoxyphenyl2,6-di-O-benzyl-3,4-O-isopropylidene-b-D-galactopyranose
- β-<span class="text-smallcaps">D</span>-Galactopyranoside, 4-methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-
- β-D-Galactopyranoside, 4-methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-
- 4-Methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-β-D-galactopyranoside

β-D-Galactopyranoside, 4-methoxyphenyl 3,4-O-(1-methylethylidene)-2,6-bis-O-(phenylmethyl)-
Ref: IN-DA001RJ1
1g | 103.00 € | ||
250mg | 54.00 € |

4-Methoxyphenyl 2,6-Di-O-benzyl-3,4-O-isopropylidene-β-D-galactopyranoside
Ref: 3B-M1633
1g | 85.00 € | ||
5g | 281.00 € |

4-Methoxyphenyl 2,6-di-O-benzyl-3,4-O-isopropylidene-b-D-galactopyranose
Ref: 3D-MM07047
1g | 363.00 € | ||
500mg | 329.00 € |