CAS 16024-86-5: 2,3-Dihydro-3-(2-hydroxypropyl)-2-thioxo-4(1H)-quinazolinone
Description:2,3-Dihydro-3-(2-hydroxypropyl)-2-thioxo-4(1H)-quinazolinone, with the CAS number 16024-86-5, is a chemical compound that belongs to the quinazolinone family, characterized by a fused bicyclic structure containing both a quinazoline and a thione functional group. This compound typically exhibits a thioxo group, which contributes to its reactivity and potential biological activity. The presence of a hydroxypropyl substituent enhances its solubility and may influence its pharmacological properties. It is often studied for its potential applications in medicinal chemistry, particularly for its possible anti-inflammatory, antimicrobial, or anticancer activities. The compound's structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,3-Dihydro-3-(2-hydroxypropyl)-2-thioxo-4(1H)-quinazolinone represents a versatile scaffold in organic synthesis and pharmaceutical research.
Formula:C11H12N2O2S
InChI:InChI=1S/C11H12N2O2S/c1-7(14)6-13-10(15)8-4-2-3-5-9(8)12-11(13)16/h2-5,7,14H,6H2,1H3,(H,12,16)
InChI key:InChIKey=GGPFOCXRQWRYNE-UHFFFAOYSA-N
SMILES:O=C1C=2C=CC=CC2NC(=S)N1CC(O)C
- Synonyms:
- 2,3-Dihydro-3-(2-hydroxypropyl)-2-thioxo-4(1H)-quinazolinone
- 3-(2-hydroxypropyl)-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
- 3-[(2R)-2-hydroxypropyl]-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
- 3-[(2S)-2-hydroxypropyl]-2-thioxo-2,3-dihydroquinazolin-4(1H)-one
- 4(1H)-Quinazolinone, 2,3-dihydro-3-(2-hydroxypropyl)-2-thioxo-
- 4(3H)-Quinazolinone, 3-(2-hydroxypropyl)-2-mercapto-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4(1H)-Quinazolinone, 2,3-dihydro-3-(2-hydroxypropyl)-2-thioxo- REF: IN-DA001RSOCAS: 16024-86-5 | - - - | To inquire | Tue 11 Mar 25 |
 | 3-(2-Hydroxypropyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one REF: 3D-RAA02486CAS: 16024-86-5 | Min. 95% | To inquire | Tue 22 Apr 25 |
 | 3-(2-hydroxypropyl)-2-sulfanylidene-1,2,3,4-tetrahydroquinazolin-4-one REF: 10-F643458CAS: 16024-86-5 | 97% | - - - | Discontinued product |
4(1H)-Quinazolinone, 2,3-dihydro-3-(2-hydroxypropyl)-2-thioxo-
Ref: IN-DA001RSO
| Undefined size | To inquire |
3-(2-Hydroxypropyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one
Ref: 3D-RAA02486
| 5g | 1,941.00 € | ||
| 500mg | 559.00 € |
3-(2-hydroxypropyl)-2-sulfanylidene-1,2,3,4-tetrahydroquinazolin-4-one
Ref: 10-F643458
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 2.5g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
