CAS 160295-81-8: H-Phe-Leu-Trp-Gly-Pro-Arg-Ala-Leu-Val-OH
Description:The chemical substance with the name "H-Phe-Leu-Trp-Gly-Pro-Arg-Ala-Leu-Val-OH" and CAS number "160295-81-8" is a peptide, specifically a linear sequence of amino acids. This peptide consists of ten amino acids, including phenylalanine (Phe), leucine (Leu), tryptophan (Trp), glycine (Gly), proline (Pro), arginine (Arg), alanine (Ala), and valine (Val), with a C-terminal hydroxyl group (-OH). Peptides like this one are characterized by their specific sequence of amino acids, which determines their biological activity and function. They can play roles in various physiological processes, including hormone regulation, neurotransmission, and immune responses. The presence of aromatic amino acids such as phenylalanine and tryptophan may contribute to the peptide's interactions with biological receptors. Additionally, the peptide's structure can influence its solubility, stability, and potential therapeutic applications. Overall, this peptide represents a complex interplay of amino acids that can be studied for its biochemical properties and potential uses in medicine or biotechnology.
Formula:C53H79N13O10
InChI:InChI=1/C53H79N13O10/c1-29(2)23-39(63-46(69)36(54)25-33-15-9-8-10-16-33)49(72)64-41(26-34-27-58-37-18-12-11-17-35(34)37)47(70)59-28-43(67)66-22-14-20-42(66)51(74)61-38(19-13-21-57-53(55)56)48(71)60-32(7)45(68)62-40(24-30(3)4)50(73)65-44(31(5)6)52(75)76/h8-12,15-18,27,29-32,36,38-42,44,58H,13-14,19-26,28,54H2,1-7H3,(H,59,70)(H,60,71)(H,61,74)(H,62,68)(H,63,69)(H,64,72)(H,65,73)(H,75,76)(H4,55,56,57)
- Synonyms:
- Phe-Leu-Trp-Gly-Pro-Arg-Ala-Leu-Val
- Melanoma-Associated Antigen 3 (271-279) (Human)
- Mage-3 (271-279)
- Mage-3 Human (271-279)
- MAGE-3 Antigen (271-279) (human)
- H2N-Flwgpralv-Oh
- phenylalanylleucyltryptophylglycylprolyl-N~5~-(diaminomethylidene)ornithylalanylleucylvaline

MAGE-3 Antigen (271-279) (human) trifluoroacetate salt
Ref: 3D-FM109069
1mg | 201.00 € | ||
2mg | 348.00 € | ||
5mg | 580.00 € | ||
10mg | 961.00 € | ||
25mg | 1,965.00 € |

(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]-3-( 1H-indol-3-yl)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]am
Ref: 3D-PP50175
Undefined size | Discontinued | Request information |