CAS 1609401-00-4: 1,3,4-Thiadiazole-2-methanamine, 5-ethyl-, hydrochloride (1:2)

Description:1,3,4-Thiadiazole-2-methanamine, 5-ethyl-, hydrochloride (1:2) is a chemical compound characterized by its thiadiazole ring structure, which consists of a five-membered heterocyclic framework containing two nitrogen atoms and one sulfur atom. This compound features an ethyl group at the 5-position and a methanamine group at the 2-position of the thiadiazole ring, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and agrochemicals. The presence of the amine group suggests potential for hydrogen bonding and reactivity in organic synthesis. Its specific properties, such as melting point, solubility, and stability, can vary based on environmental conditions and the presence of other substances. Overall, this compound is of interest in medicinal chemistry and may exhibit various pharmacological effects, warranting further investigation into its biological activity and potential applications.

Formula:C₅H₉N₃S·2ClH

InChI:InChI=1S/C5H9N3S.2ClH/c1-2-4-7-8-5(3-6)9-4;;/h2-3,6H2,1H3;2*1H

InChI key:InChIKey=MYSDQROFTQLILZ-UHFFFAOYSA-N

SMILES:Cl.N=1N=C(SC1CN)CC