CAS 161308-35-6: 2-Butenedioic acid, 2-methyl-3-tetradecyl-, disodium salt, (2Z)-

Description:2-Butenedioic acid, 2-methyl-3-tetradecyl-, disodium salt, commonly referred to as a type of surfactant or emulsifier, is a chemical compound characterized by its long hydrophobic alkyl chain and polar carboxylate groups. This structure imparts amphiphilic properties, allowing it to interact with both water and oil, making it useful in various applications, including cosmetics, detergents, and food products. The presence of the disodium salt form enhances its solubility in aqueous solutions, facilitating its use in formulations. The compound typically exhibits good stability and can function effectively across a range of pH levels. Its molecular structure includes a butenedioic acid backbone, which contributes to its reactivity and potential for forming complexes with other substances. Additionally, the long tetradecyl chain provides surface activity, which can lower surface tension and improve wetting properties. Overall, this compound is valued for its ability to enhance the performance of products by improving texture, stability, and overall efficacy.

Formula:C₁₉H₃₄O₄·2Na

InChI:InChI=1S/C19H34O4.2Na/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19(22)23)16(2)18(20)21;;/h3-15H2,1-2H3,(H,20,21)(H,22,23);;/b17-16-;;

InChI key:InChIKey=NSSZWXMQHNGBLT-LSSNYKSTSA-N

SMILES:[Na].O=C(O)C(=C(C(=O)O)CCCCCCCCCCCCCC)C