CAS 161338-87-0: 5(6)-carboxyeosin diacetate
Description:5(6)-Carboxyeosin diacetate is a synthetic dye and a derivative of eosin, which is commonly used in biological and biochemical applications. This compound features a carboxylic acid functional group, which enhances its solubility in aqueous solutions, making it suitable for various staining procedures in microscopy and histology. The diacetate form indicates the presence of two acetate groups, which can influence its reactivity and interaction with biological molecules. As a fluorescent dye, it exhibits strong absorption and emission properties, allowing for effective visualization under specific wavelengths of light. Its characteristics include high stability, low toxicity, and compatibility with a range of biological systems, making it a valuable tool in research and diagnostic applications. Additionally, the presence of the carboxylic acid group may facilitate conjugation with other biomolecules, expanding its utility in labeling and tracking studies. Overall, 5(6)-carboxyeosin diacetate is recognized for its versatility and effectiveness in various scientific fields.
Formula:C50H24Br8O18
InChI:InChI=1/2C25H12Br4O9/c1-8(30)35-21-15(26)6-13-19(17(21)28)37-20-14(7-16(27)22(18(20)29)36-9(2)31)25(13)12-4-3-10(23(32)33)5-11(12)24(34)38-25;1-8(30)35-21-15(26)6-13-19(17(21)28)37-20-14(7-16(27)22(18(20)29)36-9(2)31)25(13)12-5-10(23(32)33)3-4-11(12)24(34)38-25/h2*3-7H,1-2H3,(H,32,33)
- Synonyms:
- 3',6'-bis(acetyloxy)-2',4',5',7'-tetrabromo-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-5-carboxylic acid - 3',6'-bis(acetyloxy)-2',4',5',7'-tetrabromo-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-6-carboxylic acid (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5(6)-Carboxyeosin diacetate REF: 3D-EC168531CAS: 161338-87-0 | Min. 95% | 136.00 €~1,153.00 € | Mon 07 Apr 25 |

5(6)-Carboxyeosin diacetate
Ref: 3D-EC168531
10mg | 308.00 € | ||
25mg | 452.00 € | ||
50mg | 723.00 € | ||
100mg | 1,153.00 € |