CAS 1614-20-6: Nifurprazine

Description:Nifurprazine is a chemical compound classified as a nitrofuran derivative, primarily known for its pharmacological properties. It is characterized by its yellow crystalline appearance and is soluble in organic solvents but has limited solubility in water. Nifurprazine exhibits antimicrobial and anti-inflammatory activities, making it of interest in medical applications, particularly in the treatment of respiratory infections and other inflammatory conditions. The compound functions by inhibiting bacterial growth and modulating immune responses. Its mechanism of action is thought to involve the generation of reactive nitrogen species, which can damage bacterial DNA and proteins. Nifurprazine has been studied for its potential use in various therapeutic contexts, although its clinical use may vary by region due to regulatory considerations. As with many pharmacologically active compounds, safety and efficacy profiles are crucial, and ongoing research continues to explore its full potential and any associated side effects.

Formula:C₁₀H₈N₄O₃

InChI:InChI=1S/C10H8N4O3/c11-9-5-2-7(12-13-9)1-3-8-4-6-10(17-8)14(15)16/h1-6H,(H2,11,13)

InChI key:InChIKey=XDWLRMBWIWKFNC-UHFFFAOYSA-N

SMILES:O=N(=O)C=1OC(C=CC2=NN=C(N)C=C2)=CC1