CAS 16144-92-6: 1-Amino-2,6-naphthalenedisulfonic acid

Description:1-Amino-2,6-naphthalenedisulfonic acid, with the CAS number 16144-92-6, is an organic compound characterized by its naphthalene backbone, which is substituted with two sulfonic acid groups and one amino group. This compound is typically a solid at room temperature and is soluble in water due to the presence of the sulfonic acid groups, which impart strong acidic properties. It is often used as a dye intermediate and in the synthesis of various organic compounds, particularly in the textile and dye industries. The presence of the amino group allows for further chemical modifications, making it versatile in synthetic applications. Additionally, the sulfonic acid groups enhance its reactivity and solubility, facilitating its use in aqueous environments. The compound may exhibit properties such as UV absorbance, which can be useful in analytical chemistry. Safety data should be consulted for handling, as with many sulfonic acids, it may pose hazards if ingested or if it comes into contact with skin.

Formula:C₁₀H₉NO₆S₂

InChI:InChI=1S/C10H9NO6S2/c11-10-8-3-2-7(18(12,13)14)5-6(8)1-4-9(10)19(15,16)17/h1-5H,11H2,(H,12,13,14)(H,15,16,17)

InChI key:InChIKey=VTYFKJMQQFAQJZ-UHFFFAOYSA-N

SMILES:O=S(=O)(O)C=1C=CC=2C(=CC=C(C2N)S(=O)(=O)O)C1