CAS 161581-93-7: (4-bromophenyl)(3-fluoro-4-methoxyphenyl)methanone

Description:(4-bromophenyl)(3-fluoro-4-methoxyphenyl)methanone, with the CAS number 161581-93-7, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the presence of the methanone moiety, which is attached to two distinct phenyl groups. One of these groups contains a bromine substituent at the para position, while the other has a fluorine atom and a methoxy group at the meta and para positions, respectively. This substitution pattern contributes to the compound's unique electronic properties and potential reactivity. The presence of halogens (bromine and fluorine) and a methoxy group can influence the compound's polarity, solubility, and overall chemical behavior. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. Additionally, the presence of multiple functional groups may allow for various chemical transformations, making it a versatile building block in organic synthesis.

Formula:C₁₄H₁₀BrFO₂

InChI:InChI=1/C14H10BrFO2/c1-18-13-7-4-10(8-12(13)16)14(17)9-2-5-11(15)6-3-9/h2-8H,1H3

Synonyms:
Methanone, (4-bromophenyl)(3-fluoro-4-methoxyphenyl)-
(4-Bromophenyl)(3-fluoro-4-methoxyphenyl)methanone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Methanone, (4-bromophenyl)(3-fluoro-4-methoxyphenyl)- REF: IN-DA001VPVCAS: 161581-93-7	- - -	To inquire	Thu 13 Mar 25
4-Bromo-3'-fluoro-4'-methoxybenzophenone REF: 54-PC2419CAS: 161581-93-7	97%	To inquire	Fri 14 Mar 25
4-Bromo-3'-fluoro-4'-methoxybenzophenone REF: 10-F022678CAS: 161581-93-7	97.0%	- - -	Discontinued product
(4-Bromophenyl)(3-Fluoro-4-Methoxyphenyl)Methanone REF: 3D-FB92075CAS: 161581-93-7	Min. 95%	- - -	Discontinued product