CAS 161886-22-2: (3,4-Difluorophenyl)hydrazine

Description:(3,4-Difluorophenyl)hydrazine is an organic compound characterized by the presence of a hydrazine functional group attached to a phenyl ring that has two fluorine substituents at the 3 and 4 positions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of various biologically active compounds. The presence of fluorine atoms enhances its chemical stability and can influence its reactivity, making it a valuable building block in medicinal chemistry. As with many hydrazine derivatives, (3,4-Difluorophenyl)hydrazine may exhibit toxicity and should be handled with care, following appropriate safety protocols. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest for its unique structural features and potential utility in chemical synthesis.

Formula:C₆H₆F₂N₂

InChI:InChI=1S/C6H6F2N2/c7-5-2-1-4(10-9)3-6(5)8/h1-3,10H,9H2

InChI key:InChIKey=KBSCNXDDCDSLLP-UHFFFAOYSA-N

SMILES:FC1=CC=C(C=C1F)NN

Synonyms:
(3,4-Difluorophenyl)hydrazine
3,4-Difluorophenylhydrazine,98%
Chembrdg-Bb 4006274
Hydrazine, (3,4-difluorophenyl)-
Hydrazine, (3,4-difluorophenyl)- (9CI)
Timtec-Bb Sbb010210
3,4-Difluorophenylhydrazine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Hydrazine, (3,4-difluorophenyl)- REF: IN-DA001VXZCAS: 161886-22-2	- - -	To inquire	Thu 27 Mar 25
3,4-Difluorophenylhydrazine REF: 54-PC0636CAS: 161886-22-2	- - -	To inquire	Fri 28 Mar 25
(3,4-Difluorophenyl)hydrazine REF: 10-F678781CAS: 161886-22-2	95+%	- - -	Discontinued product
(3,4-Difluorophenyl)-Hydrazine REF: 3D-FD79727CAS: 161886-22-2	Min. 95%	- - -	Discontinued product