CAS 162291-01-2: (S)-(+)-1-[(R)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldiphenylphosphine
Description:(S)-(+)-1-[(R)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldiphenylphosphine is a chiral organophosphorus compound notable for its application in asymmetric synthesis and catalysis. This compound features a ferrocenyl moiety, which contributes to its stability and unique electronic properties, making it useful in various catalytic processes. The presence of dicyclohexylphosphino groups enhances its steric and electronic characteristics, allowing it to effectively coordinate with transition metals, thereby facilitating catalytic reactions. The compound's chirality is significant, as it can influence the selectivity and efficiency of reactions, particularly in the synthesis of enantiomerically pure compounds. Additionally, its diphenylphosphine structure provides further versatility in coordination chemistry. Overall, this compound exemplifies the intersection of organometallic chemistry and asymmetric catalysis, showcasing the importance of ligand design in enhancing catalytic performance.
Formula:C36H44FeP2
InChI:InChI=1/C31H39P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h2-3,6-9,14-18,23-25,28-29H,4-5,10-13,19-22H2,1H3;1-5H;/t25-;;/m0../s1
- Synonyms:
- (S)1[(1R)2(di-C-hexylphosphino)ferrocen. ]et-diphenylphosphin
- (S)-1-[(1R)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldi-phenylphosphine
- 1,2,3,4,5-cyclopentanepentayl, compd. with 1-(dicyclohexylphosphino)-2-[(1S)-1-(diphenylphosphino)ethyl]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1)
- (S,S)-1-(Dicyclohexylphosphino)-2-[1-(Diphenylphosphino)Ethyl]Ferrocene

Ferrocene, 1-(dicyclohexylphosphino)-2-[(1S)-1-(diphenylphosphino)ethyl]-, (1S)-
Ref: IN-DA001SZ1
1g | 148.00 € | ||
5g | 503.00 € | ||
100mg | 45.00 € | ||
250mg | 59.00 € |

(S)-1-[(S)-2-(Dicyclohexylphosphino)Ferrocenylethyl]Diphenylphosphine
Ref: 54-OR1008610
1g | 140.00 € | ||
5g | 436.00 € | ||
25g | 1,901.00 € | ||
100mg | 32.00 € | ||
250mg | 51.00 € |

(S)-(+)-1-[(R)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldiphenylphosphine, min. 97%
Ref: 08-26-1101
2g | 1,254.00 € | ||
10g | 5,319.00 € | ||
100mg | 141.00 € | ||
500mg | 468.00 € |

(S)-(+)-1-[(R)-2-(Dicyclohexylphosphino)ferrocenyl]ethyldiphenylphosphine
Ref: 3D-MGA29101
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |