CAS 1630-79-1: 1,1,2,2-Diborane(4)tetramine, N1,N1,N1′,N1′,N2,N2,N2′,N2′-octamethyl-
Description:1,1,2,2-Diborane(4)tetramine, also known as N1,N1,N1′,N1′,N2,N2,N2′,N2′-octamethyl-, is a chemical compound characterized by its unique structure that includes boron and nitrogen atoms. This compound features a diborane core, which is a key characteristic of boron compounds, and is further substituted with multiple amine groups. The presence of octamethyl groups indicates a high degree of methylation, which can influence the compound's reactivity and stability. Typically, such compounds exhibit interesting properties, including potential applications in materials science and as precursors in organic synthesis. The presence of both boron and nitrogen in the structure may also impart unique electronic properties, making it a subject of interest in coordination chemistry. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as temperature and pressure. Overall, 1,1,2,2-Diborane(4)tetramine is notable for its complex structure and potential utility in various chemical applications.
Formula:C8H24B2N4
InChI:InChI=1S/C8H24B2N4/c1-11(2)9(12(3)4)10(13(5)6)14(7)8/h1-8H3
InChI key:InChIKey=KMCDRSZVZMXKRL-UHFFFAOYSA-N
SMILES:B(B(N(C)C)N(C)C)(N(C)C)N(C)C
- Synonyms:
- 1,1,2,2-Diborane(4)tetramine, N<sup>1</sup>,N<sup>1</sup>,N<sup>1′</sup>,N<sup>1′</sup>,N<sup>2</sup>,N<sup>2</sup>,N<sup>2′</sup>,N<sup>2′</sup>-octamethyl-
- 1,1,2,2-Tetrakis(dimethylamino)diborane(4)
- Diborane(4), tetrakis(dimethylamino)-
- Diborane(4)tetramine, octamethyl-
- N,N',N'',N'''-diborane-1,1,2,2-tetrayltetrakis(N-methylmethanamine)
- NSC 220326
- NSC 665722
- Tetrakis(dimethylamino)diborane
- Tetrakis(dimethylamino)diborane(4)
- Tetrakis(dimethylamino)diboron
- See more synonyms
- 1,1,2,2-Diborane(4)tetramine, N1,N1,N1′,N1′,N2,N2,N2′,N2′-octamethyl-
