CAS 16331-48-9: 4-Acetamidobenzoyl chloride
Description:4-Acetamidobenzoyl chloride, with the CAS number 16331-48-9, is an organic compound that belongs to the class of acyl chlorides. It is characterized by the presence of both an acetamido group and a benzoyl chloride moiety, making it a versatile intermediate in organic synthesis. This compound typically appears as a white to light yellow solid and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily undergo nucleophilic substitution reactions. It is soluble in organic solvents such as dichloromethane and ether but is generally insoluble in water. The compound is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Its applications include serving as a reagent in the synthesis of various pharmaceuticals and agrochemicals, particularly in the formation of amides and other derivatives. As with many acyl chlorides, appropriate safety measures should be taken when handling this substance due to its corrosive nature and potential to cause irritation.
Formula:C9H8ClNO2
InChI:InChI=1/C9H8ClNO2/c1-6(12)11-8-4-2-7(3-5-8)9(10)13/h2-5H,1H3,(H,11,12)
- Synonyms:
- 4-(Acetylamino)Benzoyl Chloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-Acetamidobenzoyl chloride, 95% REF: 02-L18432CAS: 16331-48-9 | 95% | To inquire | Fri 21 Mar 25 |
 | Benzoyl chloride, 4-(acetylamino)- REF: IN-DA001U12CAS: 16331-48-9 | 95% | 78.00 €~193.00 € | Thu 27 Mar 25 |
 | 4-Acetamidobenzoyl chloride REF: 54-OR926403CAS: 16331-48-9 | 95% | 139.00 €~306.00 € | Thu 03 Apr 25 |
 | 4-ACETAMIDOBENZOYL CHLORIDE REF: 10-F532532CAS: 16331-48-9 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 4-Acetamidobenzoyl chloride REF: 3D-RAA33148CAS: 16331-48-9 | Min. 95% | - - - | Discontinued product |
4-Acetamidobenzoyl chloride, 95%
Ref: 02-L18432
| 1g | To inquire | ||
| 5g | To inquire |
Benzoyl chloride, 4-(acetylamino)-
Ref: IN-DA001U12
| 200mg | 78.00 € |
4-Acetamidobenzoyl chloride
Ref: 54-OR926403
| 1g | 139.00 € | ||
| 5g | 306.00 € |
4-Acetamidobenzoyl chloride
Ref: 3D-RAA33148
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 2500mg | Discontinued | Request information |
