CAS 16338-97-9: N-Nitroso-N-2-propen-1-yl-2-propen-1-amine

Description:N-Nitroso-N-2-propen-1-yl-2-propen-1-amine, with the CAS number 16338-97-9, is a nitrosamine compound that is characterized by the presence of a nitroso group (-N=O) attached to an amine. This compound is typically synthesized through the reaction of secondary amines with nitrous acid. Nitrosamines are known for their potential carcinogenic properties, making them a subject of concern in various fields, including environmental science and toxicology. The structure of this compound features a propenyl group, which contributes to its reactivity and stability under certain conditions. In terms of physical properties, nitrosamines can vary widely, but they are generally volatile and may exhibit low solubility in water. Due to their potential health risks, compounds like N-Nitroso-N-2-propen-1-yl-2-propen-1-amine are often studied for their effects on human health and the environment, particularly in relation to food safety and industrial processes. Proper handling and disposal measures are essential when working with such substances.

Formula:C₆H₁₀N₂O

InChI:InChI=1S/C6H10N2O/c1-3-5-8(7-9)6-4-2/h3-4H,1-2,5-6H2

InChI key:InChIKey=GRYFJBRXMFVEIL-UHFFFAOYSA-N

SMILES:O=NN(CC=C)CC=C