CAS 16361-24-3: 5-CHLORO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID

Description:5-Chloro-benzo[b]thiophene-3-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzo[b]thiophene ring system substituted with a chlorine atom and a carboxylic acid functional group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid group. The chlorine substituent can influence the compound's electronic properties, making it more reactive in certain chemical reactions, such as nucleophilic substitutions. The carboxylic acid group contributes to its acidity and solubility in polar solvents. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic pathways. Additionally, its structural features may allow for interactions with biological targets, making it a candidate for further research in medicinal chemistry. Overall, 5-chloro-benzo[b]thiophene-3-carboxylic acid is a versatile compound with significant implications in chemical research and application.

Formula:C₉H₅ClO₂S

InChI:InChI=1/C9H5ClO2S/c10-5-1-2-8-6(3-5)7(4-13-8)9(11)12/h1-4H,(H,11,12)

Synonyms:
Rarechem Al Bo 0996
5-Chlro-Benzo[B]Thiophene-3-Carboxylicacid
5-Chloro-benzo[b]thiophene-3-carboxylic acid ,97%
5-Chloro-1-Benzothiophene-3-Carboxylic Acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzo[b]thiophene-3-carboxylic acid, 5-chloro- REF: IN-DA001UA8CAS: 16361-24-3	97%	To inquire	Thu 27 Mar 25
5-Chloro-benzo[b]thiophene-3-carboxylic acid REF: 54-OR322431CAS: 16361-24-3	- - -	To inquire	Thu 03 Apr 25
5-Chloro-benzo[b]thiophene-3-carboxylic acid REF: 3D-RAA36124CAS: 16361-24-3	Min. 95%	To inquire	Thu 08 May 25
5-Chloro-benzo[b]thiophene-3-carboxylic acid REF: 10-F635812CAS: 16361-24-3	95%	- - -	Discontinued product