CAS 1638761-59-7: Phenylmethyl 3-formyl-1-azetidinecarboxylate

Description:Phenylmethyl 3-formyl-1-azetidinecarboxylate is a chemical compound characterized by its unique structural features, which include an azetidine ring, a formyl group, and an ester functional group. The azetidine ring, a four-membered nitrogen-containing heterocycle, contributes to the compound's potential biological activity and reactivity. The presence of the formyl group indicates that it can participate in various chemical reactions, such as nucleophilic additions or condensation reactions, making it versatile in synthetic organic chemistry. Additionally, the phenylmethyl group enhances the compound's lipophilicity, which may influence its solubility and interaction with biological systems. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the synthesis of novel pharmaceuticals. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or literature references for precise characterization. Overall, Phenylmethyl 3-formyl-1-azetidinecarboxylate represents a complex structure with potential utility in various chemical and pharmaceutical applications.

Formula:C₁₂H₁₃NO₃

InChI:InChI=1S/C12H13NO3/c14-8-11-6-13(7-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,8,11H,6-7,9H2

InChI key:InChIKey=RNLJBLXJVHYAEA-UHFFFAOYSA-N

SMILES:O=CC1CN(C(=O)OCC=2C=CC=CC2)C1

Synonyms:
Phenylmethyl 3-formyl-1-azetidinecarboxylate
1-Azetidinecarboxylic acid, 3-formyl-, phenylmethyl ester
Benzyl 3-formylazetidine-1-carboxylate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-Azetidinecarboxylic acid, 3-formyl-, phenylmethyl ester REF: IN-DA00QC37CAS: 1638761-59-7	97%	To inquire	Thu 27 Mar 25
Benzyl 3-formylazetidine-1-carboxylate REF: 54-OR87320CAS: 1638761-59-7	95%	429.00 €~1,280.00 €	Fri 28 Mar 25
Benzyl 3-formylazetidine-1-carboxylate REF: 10-F762653CAS: 1638761-59-7	97+%	180.00 €~706.00 €	Tue 01 Apr 25
Benzyl 3-formylazetidine-1-carboxylate REF: 3D-NQC76159CAS: 1638761-59-7	Min. 95%	- - -	Discontinued product