CAS 16401-41-5: (THIEN-3-YLMETHYL)THIO]ACETIC ACID

Description: (Thien-3-ylmethyl)thio)acetic acid, with the CAS number 16401-41-5, is an organic compound characterized by the presence of a thienyl group, which is a five-membered aromatic ring containing sulfur. This compound features a thioether functional group, indicating the presence of a sulfur atom bonded to a carbon atom, and a carboxylic acid group, which contributes to its acidic properties. The thienyl moiety can influence the compound's reactivity and solubility, often enhancing its biological activity. The presence of the thioether and carboxylic acid functionalities suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, although specific biological activities would require empirical investigation. Overall, (thien-3-ylmethyl)thio)acetic acid represents a unique structure that combines aromaticity with functional groups that can participate in various chemical reactions.

Formula: C₇H₇O₂S₂

InChI: InChI=1/C7H8O2S2/c8-7(9)5-11-4-6-1-2-10-3-6/h1-3H,4-5H2,(H,8,9)/p-1

Synonyms:

• [(Thiophen-3-Ylmethyl)Sulfanyl]Acetic Acid
• [(Thiophen-3-Ylmethyl)Sulfanyl]Acetate

2-[(Thiophen-3-ylmethyl)sulfanyl]acetic acid

CAS: 16401-41-5

Versatile small molecule scaffold

• Formula: C₇H₈O₂S₂
• Purity: Min. 95%
• Molecular weight: 188.3 g/mol

2-[(thiophen-3-ylmethyl)sulfanyl]acetic acid

CAS: 16401-41-5

• Purity: 98%
• Molecular weight: 188.25999450683594