CAS 164462-16-2: Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3)
Description:Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3), commonly referred to as sodium bis(carboxymethyl)alaninate, is a derivative of the amino acid alanine. This compound features two carboxymethyl groups attached to the nitrogen atom of the alanine backbone, enhancing its solubility and reactivity in aqueous solutions. As a sodium salt, it is typically more soluble in water compared to its free acid form, making it useful in various biochemical applications. The presence of multiple carboxyl groups imparts chelating properties, allowing it to interact with metal ions, which can be beneficial in applications such as metal ion sequestration or as a stabilizing agent in formulations. Additionally, its structure contributes to its potential role as a buffering agent in biological systems. The compound is generally considered safe for use in laboratory and industrial settings, although standard safety precautions should be observed. Its applications may extend to pharmaceuticals, biochemistry, and as a reagent in organic synthesis.
Formula:C7H11NO6·3Na
InChI:InChI=1S/C7H11NO6.3Na/c1-4(7(13)14)8(2-5(9)10)3-6(11)12;;;/h4H,2-3H2,1H3,(H,9,10)(H,11,12)(H,13,14);;;
InChI key:InChIKey=SQKOOOSPGWXVRN-UHFFFAOYSA-N
SMILES:[Na].O=C(O)CN(CC(=O)O)C(C(=O)O)C
- Synonyms:
- <span class="text-smallcaps">DL</span>-Alanine, N,N-bis(carboxymethyl)-, trisodium salt
- <span class="text-smallcaps">DL</span>-Alanine-N,N-diacetic acid trisodium salt
- Alanine, N,N-bis(carboxymethyl)-, sodium salt (1:3)
- Alanine, N,N-bis(carboxymethyl)-, trisodium salt
- DL-Alanine-N,N-diacetic acid trisodium salt
- Dissolvine M 40
- N,N-Bis(carboxymethyl)-DL-alanine, trisodium salt
- N-(1-Carboxylatoethyl)Iminodiacetic Acid Trisodium Salt
- Trisodium 2-Methylnitrilotriacetate
- Trisodium 2-[Bis(Carboxylatomethyl)Amino]Propanoate
- See more synonyms
- Trisodium Dicarboxymethyl Alaninate
- Trisodium N-(1-Carboxylatoethyl)Iminodiacetate
- DL-Alanine, N,N-bis(carboxymethyl)-, trisodium salt
