CAS 16499-61-9: 4-CHLORO-6-FLUOROQUINAZOLINE

Description:4-Chloro-6-fluoroquinazoline is a heterocyclic organic compound characterized by a quinazoline core, which consists of a fused benzene and pyrimidine ring structure. The presence of chlorine and fluorine substituents at the 4 and 6 positions, respectively, contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinazolines are known for their diverse biological activities, including anticancer and antimicrobial properties. The presence of halogen atoms can enhance the lipophilicity and bioavailability of the compound. Additionally, 4-chloro-6-fluoroquinazoline may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula:C₈H₄ClFN₂

InChI:InChI=1/C8H4ClFN2/c9-8-6-3-5(10)1-2-7(6)11-4-12-8/h1-4H

Synonyms:
Quinazoline, 4-Chloro-6-Fluoro-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Chloro-6-fluoroquinazoline REF: IN-DA007B26CAS: 16499-61-9	96%	28.00 €~480.00 €	Mon 24 Mar 25
4-Chloro-6-fluoroquinazoline REF: 54-PC400552CAS: 16499-61-9	98+%	77.00 €~908.00 €	Tue 25 Mar 25
4-Chloro-6-fluoroquinazoline REF: 10-F078812CAS: 16499-61-9	95.0%	To inquire	Thu 03 Apr 25
4-Chloro-6-fluoroquinazoline REF: 3D-FC41997CAS: 16499-61-9	Min. 95%	- - -	Discontinued product