CAS 165315-96-8: 12-Oxa-2,7,10-triazatetradecanoic acid, 4-hydroxy-13,13-dimethyl-9-(1-methylethyl)-8,11-dioxo-3,6-bis(phenylmethyl)-, 5-thiazolylmethyl ester, [3S-(3R*,4R*,6R*,9R*)]-
Description:12-Oxa-2,7,10-triazatetradecanoic acid, with the CAS number 165315-96-8, is a complex organic compound characterized by its unique structural features, including a long carbon chain and multiple functional groups. This compound contains a thiazole moiety, which contributes to its potential biological activity, and features multiple chiral centers, indicating that it may exist in several stereoisomeric forms. The presence of hydroxyl and keto groups suggests it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The phenylmethyl groups may enhance lipophilicity, potentially affecting its interaction with biological membranes. Additionally, the oxo and thiazolylmethyl ester functionalities may play a role in its reactivity and stability. Overall, this compound's intricate structure suggests it could have applications in medicinal chemistry or materials science, although specific biological or chemical properties would require further investigation through empirical studies.
Formula:C33H44N4O6S
InChI:InChI=1S/C33H44N4O6S/c1-22(2)29(37-32(41)43-33(3,4)5)30(39)35-25(16-23-12-8-6-9-13-23)18-28(38)27(17-24-14-10-7-11-15-24)36-31(40)42-20-26-19-34-21-44-26/h6-15,19,21-22,25,27-29,38H,16-18,20H2,1-5H3,(H,35,39)(H,36,40)(H,37,41)/t25-,27-,28-,29-/m0/s1
InChI key:InChIKey=YTUZKKZZDRSLNF-AMEOFWRWSA-N
SMILES:O=C(OCC=1SC=NC1)NC(CC=2C=CC=CC2)C(O)CC(NC(=O)C(NC(=O)OC(C)(C)C)C(C)C)CC=3C=CC=CC3

4-Hydroxy-13,13-dimethyl-9-(1-methylethyl)-8,11-dioxo-3,6-bis(phenylmethyl) 12-Oxa-2,7,10-triazatetradecanoic Acid 5-Thiazolylmethyl Ester
Controlled ProductRef: TR-H825410
1g | 1,136.00 € |

4-Hydroxy-13,13-dimethyl-9-(1-methylethyl)-8,11-dioxo-3,6-bis(phenylmethyl) 12-oxa-2,7,10-triazatetradecanoic acid 5-thiazolylmethyl ester
Ref: 3D-QGA31596
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |