CAS 1655-68-1: 1-Methoxy-3-phenoxybenzene

Description:1-Methoxy-3-phenoxybenzene, also known as an ether compound, is characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a phenoxy group (-O-C6H5) attached to a benzene ring. This compound typically exhibits a colorless to pale yellow liquid form and is known for its moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. Its molecular structure contributes to its potential applications in various fields, including organic synthesis and as an intermediate in the production of agrochemicals or pharmaceuticals. The presence of both methoxy and phenoxy groups can influence its reactivity, making it a candidate for electrophilic substitution reactions. Additionally, 1-Methoxy-3-phenoxybenzene may exhibit specific physical properties such as a distinct boiling point and melting point, which are influenced by intermolecular forces like van der Waals interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula:C₁₃H₁₂O₂

InChI:InChI=1S/C13H12O2/c1-14-12-8-5-9-13(10-12)15-11-6-3-2-4-7-11/h2-10H,1H3

InChI key:InChIKey=CBVXNDCIOLXDFD-UHFFFAOYSA-N

SMILES:O(C=1C=CC=CC1)C2=CC=CC(OC)=C2

Synonyms:
1-Methoxy-3-Phenoxybenzene
3-Methoxydiphenyl ether
3-Methoxyphenoxybenzene
3-Phenoxyanisole
Benzene, 1-methoxy-3-phenoxy-
NSC 57097
m-Methoxyphenyl phenyl ether
m-Phenoxymethoxybenzene
m-Phenoxyphenol monomethyl ether

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3-Phenoxyanisole, 97% REF: 02-H32482CAS: 1655-68-1	97%	To inquire	Fri 21 Mar 25
Benzene, 1-methoxy-3-phenoxy- REF: IN-DA001W6BCAS: 1655-68-1	97%	To inquire	Thu 27 Mar 25
3-Phenoxyanisole REF: TM-T29418CAS: 1655-68-1	- - -	To inquire	Fri 28 Mar 25