
CAS 165524-52-7: (αR,4S)-α,2,2-Trimethyl-1,3-dioxolane-4-methanol
Description:(αR,4S)-α,2,2-Trimethyl-1,3-dioxolane-4-methanol is a chemical compound characterized by its unique structural features, including a dioxolane ring and multiple methyl groups. This compound is a chiral molecule, which means it has non-superimposable mirror images due to the presence of stereocenters, specifically at the α and 4 positions. The dioxolane moiety contributes to its stability and reactivity, making it of interest in various synthetic applications. The presence of the hydroxymethyl group at the 4 position enhances its potential for further functionalization and reactivity in organic synthesis. Additionally, the compound's stereochemistry can influence its physical properties, such as boiling point and solubility, as well as its biological activity, making it relevant in fields like medicinal chemistry and materials science. Overall, (αR,4S)-α,2,2-Trimethyl-1,3-dioxolane-4-methanol is a versatile compound with potential applications in both research and industry.
Formula:C7H14O3
InChI:InChI=1S/C7H14O3/c1-5(8)6-4-9-7(2,3)10-6/h5-6,8H,4H2,1-3H3/t5-,6+/m1/s1
InChI key:InChIKey=YJZDTHNWQIMGBF-RITPCOANSA-N
SMILES:OC(C)C1OC(OC1)(C)C
- Synonyms:
- 1,3-Dioxolane-4-methanol, α,2,2-trimethyl-, (αR,4S)-
- (αR,4S)-α,2,2-Trimethyl-1,3-dioxolane-4-methanol
- (1R)-1-((4S)-2,2-Dimethyl-1,3-dioxolan-4-yl)ethanol
- 1,3-Dioxolane-4-methanol, α,2,2-trimethyl-, [S-(R*,S*)]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (R)-1-((S)-2,2-Dimethyl-1,3-dioxolan-4-yl)ethanol REF: 10-F760406CAS: 165524-52-7 | 98% | - - - | Discontinued product |
![]() | (1R)-1-[(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]ethan-1-ol REF: 3D-QGA52452CAS: 165524-52-7 | Min. 95% | - - - | Discontinued product |

(R)-1-((S)-2,2-Dimethyl-1,3-dioxolan-4-yl)ethanol
Ref: 10-F760406
1g | Discontinued | Request information |

(1R)-1-[(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]ethan-1-ol
Ref: 3D-QGA52452
5g | Discontinued | Request information |