CAS 166599-76-4: Methanone,(4-methoxy-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-

Description:Methanone, specifically the compound with the name "Methanone, (4-methoxy-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-" and CAS number 166599-76-4, is a complex organic molecule characterized by its unique structural features. It contains a naphthalene moiety substituted with a methoxy group, which contributes to its aromatic properties and potential for various interactions. The presence of an indole structure linked to a morpholine group suggests that this compound may exhibit interesting biological activities, possibly related to its ability to interact with biological targets. The morpholine ring can enhance solubility and bioavailability, making it a candidate for pharmaceutical applications. Additionally, the compound's overall structure indicates potential for π-π stacking interactions due to the aromatic systems, which may influence its behavior in solution and solid-state. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry and material science, although specific properties such as solubility, melting point, and reactivity would require empirical investigation for detailed understanding.

Formula:C₂₆H₂₆N₂O₃

InChI:InChI=1S/C26H26N2O3/c1-30-25-11-10-22(19-6-2-3-8-21(19)25)26(29)23-18-28(24-9-5-4-7-20(23)24)13-12-27-14-16-31-17-15-27/h2-11,18H,12-17H2,1H3

InChI key:InChIKey=QWHSUXWDDKWTOG-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(OC)C=2C=CC=CC21)C3=CN(C=4C=CC=CC34)CCN5CCOCC5

Synonyms:
Methanone, (4-methoxy-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]-
(4-Methoxy-1-naphthalenyl)[1-[2-(4-morpholinyl)ethyl]-1H-indol-3-yl]methanone
JWH 198