CAS 166904-09-2: 3-methoxy-4-(4-nitrophenoxy)benzaldehyde

Description:3-Methoxy-4-(4-nitrophenoxy)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a methoxy group and a nitrophenoxy substituent on a benzaldehyde framework. This compound features a methoxy (-OCH3) group at the 3-position and a nitrophenoxy (-O-C6H4-NO2) group at the 4-position of the benzene ring, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The nitro group (-NO2) is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This substance may exhibit interesting properties such as fluorescence or photochemical activity, making it of interest in fields like materials science and medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations for its practical applications.

Formula:C₁₄H₁₁NO₅

InChI:InChI=1/C14H11NO5/c1-19-14-8-10(9-16)2-7-13(14)20-12-5-3-11(4-6-12)15(17)18/h2-9H,1H3

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzaldehyde, 3-methoxy-4-(4-nitrophenoxy)- REF: IN-DA001WZICAS: 166904-09-2	- - -	To inquire	Thu 27 Mar 25
3-methoxy-4-(4-nitrophenoxy)benzaldehyde REF: 10-F314148CAS: 166904-09-2	95.0%	To inquire	Tue 08 Apr 25
3-Methoxy-4-(4-nitrophenoxy)benzaldehyde REF: 3D-RGA90409CAS: 166904-09-2	Min. 95%	- - -	Discontinued product