CAS 167626-26-8: Benzoic acid, 3-hydrazinyl-, methyl ester, hydrochloride (1:1)

Description:Benzoic acid, 3-hydrazinyl-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzoic acid moiety, a hydrazine functional group, and a methyl ester. The presence of the hydrazine group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the hydrochloride, affecting its stability and reactivity. Additionally, the compound's characteristics, such as melting point, solubility, and spectral properties, can be determined through various analytical techniques, including NMR and IR spectroscopy. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and medicinal chemistry.

Formula:C₈H₁₀N₂O₂·ClH

InChI:InChI=1S/C8H10N2O2.ClH/c1-12-8(11)6-3-2-4-7(5-6)10-9;/h2-5,10H,9H2,1H3;1H

InChI key:InChIKey=OBALLCFRLYMDPH-UHFFFAOYSA-N

SMILES:Cl.O=C(OC)C=1C=CC=C(C1)NN

Synonyms:
Benzoic acid, 3-hydrazino-, methyl ester, monohydrochloride
Benzoic acid, 3-hydrazinyl-, methyl ester, hydrochloride (1:1)
3-Hydrazinobenzoic acid methyl ester hydrochloride
Methyl 3-hydrazinobenzoate hydrochloride

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 3-hydrazino-, methyl ester, monohydrochloride REF: IN-DA00HZ79CAS: 167626-26-8	95%	To inquire	Thu 27 Mar 25
Methyl 3-hydrazinylbenzoate hydrochloride REF: 54-OR83289CAS: 167626-26-8	95%	166.00 €~396.00 €	Fri 28 Mar 25
Methyl 3-hydrazinylbenzoate hydrochloride REF: 10-F692346CAS: 167626-26-8	95%	83.00 €~213.00 €	Tue 01 Apr 25
Methyl 3-hydrazinylbenzoate hydrochloride REF: 3D-SGA62626CAS: 167626-26-8	Min. 95%	To inquire	Thu 08 May 25