CAS 167626-65-5: 2-(4H-1,2,4-Triazol-4-yl)benzoic acid

Description:2-(4H-1,2,4-Triazol-4-yl)benzoic acid, with the CAS number 167626-65-5, is an organic compound characterized by the presence of a benzoic acid moiety and a 1,2,4-triazole ring. This compound typically exhibits properties such as being a white to off-white solid, which is soluble in polar solvents like water and methanol, while being less soluble in non-polar solvents. The triazole ring contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly for its antifungal and antimicrobial properties. The carboxylic acid functional group in the benzoic acid part allows for hydrogen bonding, enhancing its solubility and reactivity. Additionally, the compound may exhibit acidic behavior due to the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Its unique structure and functional groups make it a valuable compound in medicinal chemistry and material science.

Formula:C₉H₇N₃O₂

InChI:InChI=1S/C9H7N3O2/c13-9(14)7-3-1-2-4-8(7)12-5-10-11-6-12/h1-6H,(H,13,14)

InChI key:InChIKey=PFRSCKSDWKIZSR-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=CC=CC1N2C=NN=C2

Synonyms:
2-(1,2,4-Triazol-4-yl)benzoic acid
benzoic acid, 2-(4H-1,2,4-triazol-4-yl)-
2-(4H-1,2,4-Triazol-4-yl)benzoic acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 2-(4H-1,2,4-triazol-4-yl)- REF: IN-DA001XIFCAS: 167626-65-5	- - -	To inquire	Thu 27 Mar 25
2-(4H-1,2,4-Triazol-4-yl)benzoic acid REF: 10-F311525CAS: 167626-65-5	95.0%	- - -	Discontinued product
2-(4H-1,2,4-Triazol-4-yl)benzoicacid REF: 3D-SGA62665CAS: 167626-65-5	Min. 95%	- - -	Discontinued product