CAS 16929-60-5: 1,3-Bis(2-methoxyphenoxy)-2-propanol
Description:1,3-Bis(2-methoxyphenoxy)-2-propanol, with the CAS number 16929-60-5, is an organic compound characterized by its structure, which features two methoxyphenoxy groups attached to a propane backbone. This compound is typically a colorless to pale yellow liquid and is known for its solubility in organic solvents, while being less soluble in water. It exhibits properties that make it useful in various applications, including as a surfactant or emulsifier in formulations. The presence of methoxy groups contributes to its hydrophobic characteristics, enhancing its ability to interact with non-polar substances. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its stability under normal conditions and relatively low volatility are also notable characteristics. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 1,3-Bis(2-methoxyphenoxy)-2-propanol is a versatile compound with potential applications in multiple fields.
Formula:C17H20O5
InChI:InChI=1S/C17H20O5/c1-19-14-7-3-5-9-16(14)21-11-13(18)12-22-17-10-6-4-8-15(17)20-2/h3-10,13,18H,11-12H2,1-2H3
InChI key:InChIKey=SSNCGCIXFDVLFP-UHFFFAOYSA-N
SMILES:OC(COC=1C=CC=CC1OC)COC=2C=CC=CC2OC
- Synonyms:
- 1,3-Bis(2-methoxyphenoxy)-2-propanol
- 2-Propanol, 1,3-Bis(2-Methoxyphenoxy)-
- 2-Propanol, 1,3-bis(o-methoxyphenoxy)-
- NSC 142122
- 1,3-Bis(2-methoxyphenoxy)propan-2-ol
