CAS 169534-85-4: protostemotinine
Description:Protostemotinine, identified by its CAS number 169534-85-4, is a chemical compound that belongs to the class of alkaloids. It is derived from natural sources, particularly from certain plant species, and is known for its potential biological activities. The compound exhibits a complex molecular structure, which contributes to its unique properties. Protostemotinine has been studied for its pharmacological effects, including potential anti-inflammatory and anti-cancer activities, although further research is necessary to fully understand its mechanisms of action and therapeutic potential. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many alkaloids, it may also exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, bioavailability, and pharmacokinetics are essential for evaluating its safety and efficacy in potential applications.
Formula:C23H29NO6
InChI:InChI=1/C23H29NO6/c1-12-11-17(29-20(12)26)16-8-9-22-15(7-5-6-10-24(16)22)13(2)18(25)23(22)19(28-4)14(3)21(27)30-23/h12,16-17H,5-11H2,1-4H3/t12-,16-,17-,22-,23+/m0/s1
- Synonyms:
- (3S,11S,11aS)-3'-Methoxy-4',9-dimethyl-3-[(2S,4S)-4-methyl-5-oxotetrahydrofuran-2-yl]-2,3,5,6,7,8-hexahydro-1H,5'H,10H-spiro[cyclopenta[b]pyrrolo[1,2-a]azepine-11,2'-furan]-5',10-dione
- spiro[1H-cyclopenta[b]pyrrolo[1,2-a]azepine-11(10H),2'(5'H)-furan]-5',10-dione, 2,3,5,6,7,8-hexahydro-3'-methoxy-4',9-dimethyl-3-[(2S,4S)-tetrahydro-4-methyl-5-oxo-2-furanyl]-, (3S,11S,11aS)-