CAS 169750-92-9: Carbamic acid, ethyl(3-pyrrolidinylmethyl)-, 1,1-dimethylethyl ester
Description:Carbamic acid, ethyl(3-pyrrolidinylmethyl)-, 1,1-dimethylethyl ester, identified by CAS number 169750-92-9, is a chemical compound that belongs to the class of carbamates. This substance features a carbamic acid functional group, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N). The compound includes an ethyl group and a pyrrolidine ring, contributing to its structural complexity and potential biological activity. The presence of the tert-butyl ester group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, carbamates can exhibit a range of pharmacological properties, including potential use as insecticides or pharmaceuticals. However, specific characteristics such as melting point, boiling point, and reactivity would require empirical data for precise determination. Safety and handling considerations are essential, as carbamates can be toxic and may pose environmental risks. Overall, this compound's unique structure suggests potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-5-14(9-10-6-7-13-8-10)11(15)16-12(2,3)4/h10,13H,5-9H2,1-4H3
InChI key:InChIKey=NYYCZYNMSIYBIS-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N(CC)CC1CNCC1
- Synonyms:
- Carbamic acid, ethyl(3-pyrrolidinylmethyl)-, 1,1-dimethylethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ethyl-pyrrolidin-3-ylmethyl-carbamic acid tert-butyl ester REF: 10-F087932CAS: 169750-92-9 | - - - | - - - | Discontinued product |
![]() | Ethyl-pyrrolidin-3-ylmethyl-carbamic acid tert-butyl ester REF: 3D-UGA75092CAS: 169750-92-9 | Min. 95% | - - - | Discontinued product |

Ethyl-pyrrolidin-3-ylmethyl-carbamic acid tert-butyl ester
Ref: 10-F087932
1g | Discontinued | Request information |

Ethyl-pyrrolidin-3-ylmethyl-carbamic acid tert-butyl ester
Ref: 3D-UGA75092
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |