CAS 1701-20-8: 6-Methyl-2-(trifluoromethyl)-4-quinolinol

Description:6-Methyl-2-(trifluoromethyl)-4-quinolinol, with the CAS number 1701-20-8, is a chemical compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features a methyl group at the 6-position and a trifluoromethyl group at the 2-position of the quinoline ring, which significantly influences its chemical properties and reactivity. The presence of the hydroxyl group at the 4-position contributes to its potential as a weak acid, allowing for hydrogen bonding and interactions with other molecules. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its trifluoromethyl group enhances lipophilicity and can affect biological activity, making it of interest in medicinal chemistry and material science. Additionally, the unique combination of functional groups may impart specific optical and electronic properties, which can be leveraged in various applications, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and potential toxicity.

Formula:C₁₁H₈F₃NO

InChI:InChI=1S/C11H8F3NO/c1-6-2-3-8-7(4-6)9(16)5-10(15-8)11(12,13)14/h2-5H,1H3,(H,15,16)

InChI key:InChIKey=UNVMZLUVACVTDT-UHFFFAOYSA-N

SMILES:FC(F)(F)C1=NC=2C=CC(=CC2C(O)=C1)C

Synonyms:
4-Quinolinol, 6-methyl-2-(trifluoromethyl)-
6-Methyl-2-(Trifluoromethyl)Quinolin-4-Ol
6-Methyl-2-(trifluoromethyl)-4-quinolinol
6-methyl-2-(trifluoromethyl)quinolin-4(1H)-one

Found 4 products.

Product data	Purity	Price range	Estimated delivery
6-Methyl-2-(trifluoromethyl)quinolin-4-ol REF: IN-DA003LIMCAS: 1701-20-8	97%	27.00 €~459.00 €	Thu 27 Mar 25
4-Hydroxy-6-methyl-2-(trifluoromethyl)quinoline REF: 10-F006613CAS: 1701-20-8	97.0%	27.00 €~383.00 €	Tue 01 Apr 25
4-Hydroxy-6-methyl-2-(trifluoromethyl)quinoline REF: 54-PC4858ECAS: 1701-20-8	97%	42.00 €~147.00 €	Thu 03 Apr 25
4-Hydroxy-6-methyl-2-(trifluoromethyl)quinoline REF: 3D-FH55256CAS: 1701-20-8	Min. 95%	- - -	Discontinued product