CAS 17014-43-6: 1-hydroxy-2,3-dimethoxyacridin-9(10H)-one

Description:1-Hydroxy-2,3-dimethoxyacridin-9(10H)-one, with the CAS number 17014-43-6, is a chemical compound belonging to the acridine family, characterized by its fused ring structure. This compound features a hydroxyl group (-OH) and two methoxy groups (-OCH3) attached to the acridine skeleton, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit fluorescence due to its aromatic structure. The presence of the hydroxyl and methoxy groups can influence its solubility, reactivity, and potential biological activity, making it of interest in various fields, including medicinal chemistry and materials science. The compound may also participate in hydrogen bonding and other intermolecular interactions, affecting its stability and behavior in different environments. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their potential in drug development and as fluorescent probes in biochemical research.

Formula:C₁₅H₁₃NO₄

InChI:InChI=1/C15H13NO4/c1-19-11-7-10-12(14(18)15(11)20-2)13(17)8-5-3-4-6-9(8)16-10/h3-7,18H,1-2H3,(H,16,17)