CAS 170242-36-1: 2,7-Bis(2,4,6-trimethylphenyl)-9H-fluorene

Description:2,7-Bis(2,4,6-trimethylphenyl)-9H-fluorene, identified by its CAS number 170242-36-1, is an organic compound characterized by its unique structure, which features a fluorene backbone substituted at the 2 and 7 positions with bulky 2,4,6-trimethylphenyl groups. This substitution enhances its steric properties and can influence its electronic characteristics, making it of interest in materials science, particularly in organic electronics and photonics. The compound is typically solid at room temperature and exhibits good thermal stability, which is advantageous for applications in high-performance materials. Its molecular structure contributes to its potential as a light-emitting material, and it may also exhibit interesting photophysical properties, such as fluorescence. Additionally, the presence of multiple methyl groups in the substituents can affect solubility and reactivity, making it suitable for various synthetic applications. Overall, 2,7-Bis(2,4,6-trimethylphenyl)-9H-fluorene is a notable compound in the field of organic chemistry, particularly for its potential applications in advanced materials.

Formula:C₃₁H₃₀

InChI:InChI=1S/C31H30/c1-18-11-20(3)30(21(4)12-18)24-7-9-28-26(15-24)17-27-16-25(8-10-29(27)28)31-22(5)13-19(2)14-23(31)6/h7-16H,17H2,1-6H3

InChI key:InChIKey=HRTBJVPOLKULEE-UHFFFAOYSA-N

SMILES:C1=CC=2C3=CC=C(C=C3CC2C=C1C=4C(=CC(=CC4C)C)C)C5=C(C=C(C=C5C)C)C

Synonyms:
2,7-Bis(2,4,6-trimethylphenyl)fluorene
9H-Fluorene, 2,7-bis(2,4,6-trimethylphenyl)-
2,7-Bis(mesityl)fluorene
2,7-Bis(2,4,6-trimethylphenyl)-9H-fluorene

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,7-双(2,4,6-三甲基苯基)-9H-芴 REF: IN-DA01FW08CAS: 170242-36-1	97%	To inquire	Wed 26 Mar 25
2,7-Dimesityl-9H-fluorene REF: 10-F617606CAS: 170242-36-1	97%	- - -	Discontinued product
2,7-Bis(2,4,6-trimethylphenyl)-9H-fluorene REF: 3D-FB173140CAS: 170242-36-1	Min. 95%	- - -	Discontinued product