CAS 1704069-56-6: B-[4-[[(2-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid

Description:B-[4-[[(2-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid is a boronic acid derivative characterized by its unique functional groups, which include a boron atom bonded to a phenyl ring and an amide moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the methoxy and amino groups enhances its solubility and reactivity, potentially allowing for interactions with biological targets. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. The compound's structure suggests it may also exhibit specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Overall, B-[4-[[(2-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid represents a versatile building block in both synthetic and medicinal chemistry contexts.

Formula:C₁₄H₁₄BNO₄

InChI:InChI=1S/C14H14BNO4/c1-20-13-5-3-2-4-12(13)16-14(17)10-6-8-11(9-7-10)15(18)19/h2-9,18-19H,1H3,(H,16,17)

InChI key:InChIKey=BICIYGVMBIEAEG-UHFFFAOYSA-N

SMILES:O=C(NC=1C=CC=CC1OC)C2=CC=C(C=C2)B(O)O

Synonyms:
B-[4-[[(2-Methoxyphenyl)amino]carbonyl]phenyl]boronic acid
Boronic acid, B-[4-[[(2-methoxyphenyl)amino]carbonyl]phenyl]-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
(3-((3-(trifluoroMethoxy)phenyl)carbaMoyl)phenyl)boronic acid REF: IN-DA00AR7RCAS: 1704069-56-6	95%	To inquire	Thu 27 Mar 25
(4-((2-Methoxyphenyl)carbamoyl)phenyl)boronic acid REF: 10-F770808CAS: 1704069-56-6	98%	To inquire	Tue 08 Apr 25
(4-((2-Methoxyphenyl)carbamoyl)phenyl)boronic acid REF: 3D-ETC06956CAS: 1704069-56-6	Min. 95%	- - -	Discontinued product