CAS 1707-77-3: 1,2:5,6-Di-O-isopropylidene-D-mannitol
Description:1,2:5,6-Di-O-isopropylidene-D-mannitol is a chemical compound that serves as a protective derivative of D-mannitol, a sugar alcohol. This compound is characterized by the presence of two isopropylidene groups, which are acetal protecting groups that enhance the stability of the molecule and prevent unwanted reactions during synthetic processes. It is typically a white to off-white crystalline solid, soluble in organic solvents such as methanol and dichloromethane, but less soluble in water due to its hydrophobic isopropylidene groups. The compound is primarily used in organic synthesis, particularly in carbohydrate chemistry, where it acts as an intermediate in the preparation of various derivatives of sugars. Its structure allows for selective reactions at specific hydroxyl groups, making it valuable in the synthesis of more complex molecules. Additionally, it is important to handle this compound with care, as with many organic chemicals, due to potential health hazards associated with exposure.
Formula:C12H22O6
InChI:InChI=1S/C12H22O6/c1-11(2)15-5-7(17-11)9(13)10(14)8-6-16-12(3,4)18-8/h7-10,13-14H,5-6H2,1-4H3/t7-,8-,9-,10-/m1/s1
InChI key:InChIKey=ODYBCPSCYHAGHA-ZYUZMQFOSA-N
SMILES:OC(C(O)C1OC(OC1)(C)C)C2OC(OC2)(C)C
- Synonyms:
- (1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (non-preferred name)
- (1S,2S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (non-preferred name)
- 1,2,5,6-DI-Isopopylidene-D-Mannitol
- 1,2:5,6-Bis-O-(1-methylethylidene)-<span class="text-smallcaps">D</span>-mannitol
- 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol
- 1,2:5,6-Bis-o-(1-methylidene)D-mannitol
- 1,2:5,6-Di-O-isopropylidene-<span class="text-smallcaps">D</span>-mannitol
- 1,2:5,6-Diacetone-D-mannitol
- 1,2:5,6-Diisopropylidene-<span class="text-smallcaps">D</span>-mannitol
- <span class="text-smallcaps">D</span>-(+)-1,2:5,6-Di-O-isopropylidenemannitol
- See more synonyms
- <span class="text-smallcaps">D</span>-Mannitol 1,2:5,6-bis-acetonide
- <span class="text-smallcaps">D</span>-Mannitol, 1,2:5,6-bis-O-(1-methylethylidene)-
- D-mannitol diacetonide
- Diacetone-D-Mannitol
- Diisopropylidene mannitol
- Mannitol diacetonide
- Mannitol, 1,2:5,6-di-O-isopropylidene-, <span class="text-smallcaps">D</span>-
- NSC 47987
- NSC 67545
- NSC 89874
- Mannitol, 1,2:5,6-di-O-isopropylidene-, D-
- 1,2:5,6-Di-O-isopropylidene-D-mannitol
- D-Mannitol, 1,2:5,6-bis-O-(1-methylethylidene)-
- D-(+)-1,2:5,6-Di-O-isopropylidenemannitol
