CAS 17133-48-1: 2-CHLORO-1-(2,3-DIHYDRO-INDOL-1-YL)-ETHANONE
Description:2-Chloro-1-(2,3-dihydro-indol-1-yl)-ethanone is an organic compound characterized by its unique structure, which includes a chloro substituent and an indole derivative. The presence of the chloro group indicates that it is likely to exhibit reactivity typical of halogenated compounds, such as nucleophilic substitution reactions. The indole moiety contributes to its potential biological activity, as indole derivatives are known for their roles in various pharmacological applications. This compound may exhibit moderate to high lipophilicity due to the indole structure, influencing its solubility and permeability in biological systems. Additionally, the presence of the carbonyl group (ethanone) suggests potential reactivity in condensation reactions or as an electrophile in various organic transformations. Overall, 2-chloro-1-(2,3-dihydro-indol-1-yl)-ethanone is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination for precise applications.
Formula:C10H10ClNO
InChI:InChI=1/C10H10ClNO/c11-7-10(13)12-6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2
- Synonyms:
- Timtec-Bb Sbb000348
- Akos Bbs-00005425
- 1-(Chloroacetyl)Indoline
- Asischem T66737
- 2-chloro-1-(2,3-dihydro-1H-indol-1-yl)ethanone
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Chloro-1-(indolin-1-yl)ethanone REF: IN-DA003GU3CAS: 17133-48-1 | 95% | To inquire | Thu 27 Mar 25 |
 | 2-Chloro-1-(2,3-dihydro-indol-1-yl)-ethanone REF: 54-OR943541CAS: 17133-48-1 | 95% | 108.00 €~708.00 € | Fri 28 Mar 25 |
 | 2-Chloro-1-(2,3-dihydro-indol-1-yl)-ethanone REF: 10-F026260CAS: 17133-48-1 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 1-(Chloroacetyl)indoline REF: 3D-FC125681CAS: 17133-48-1 | Min. 95% | - - - | Discontinued product |
2-Chloro-1-(indolin-1-yl)ethanone
Ref: IN-DA003GU3
| 1g | 256.00 € | ||
| 5g | To inquire | ||
| 250mg | 134.00 € |
Ref: 54-OR943541
| 1g | 254.00 € | ||
| 5g | 708.00 € | ||
| 250mg | 108.00 € |
2-Chloro-1-(2,3-dihydro-indol-1-yl)-ethanone
Ref: 10-F026260
| 1g | 340.00 € | ||
| 5g | 975.00 € | ||
| 25g | To inquire |
1-(Chloroacetyl)indoline
Ref: 3D-FC125681
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
