CAS 171366-19-1: 2-FLUORO-3-(HYDROXYMETHYL)-4-IODOPYRIDINE

Description:2-Fluoro-3-(hydroxymethyl)-4-iodopyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with a fluorine atom, a hydroxymethyl group, and an iodine atom. The molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The hydroxymethyl group (-CH2OH) introduces a polar functional group, enhancing the compound's solubility in polar solvents and potentially influencing its reactivity in various chemical reactions. The presence of the iodine atom can impart unique properties, such as increased molecular weight and potential for nucleophilic substitution reactions. Additionally, the fluorine atom can affect the electronic properties of the molecule, making it more electrophilic. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could lead to applications in drug development or as a building block in organic synthesis. As with many halogenated compounds, safety and handling precautions should be observed due to potential toxicity and environmental impact.

Formula:C₆H₅FINO

InChI:InChI=1/C6H5FINO/c7-6-4(3-10)5(8)1-2-9-6/h1-2,10H,3H2

Synonyms:
(2-Fluoro-4-iodopyridin-3-yl)methanol
3-Pyridinemethanol, 2-fluoro-4-iodo-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Pyridinemethanol,2-fluoro-4-iodo- REF: IN-DA0077PVCAS: 171366-19-1	95%	26.00 €~513.00 €	Tue 11 Mar 25
(2-Fluoro-4-iodopyridin-3-yl)methanol REF: 54-PC100078CAS: 171366-19-1	95%	85.00 €~909.00 €	Wed 12 Mar 25
2-Fluoro-3-(hydroxymethyl)-4-iodopyridine REF: FT-Y15328CAS: 171366-19-1	98%	To inquire	Fri 14 Mar 25
(2-Fluoro-4-iodopyridin-3-yl)methanol REF: 10-F235139CAS: 171366-19-1	95.0%	To inquire	Fri 21 Mar 25
2-Fluoro-4-iodo-3-pyridinemethanol REF: 3D-FF81772CAS: 171366-19-1	Min. 95%	- - -	Discontinued product