CAS 171425-69-7: Benzamide, 2-bromo-5-methoxy-N-methyl-

Description:Benzamide, 2-bromo-5-methoxy-N-methyl- is an organic compound characterized by its benzamide structure, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine group (NH). The presence of a bromine atom at the 2-position and a methoxy group (-OCH3) at the 5-position on the benzene ring contributes to its unique chemical properties. The N-methyl substitution indicates that a methyl group is attached to the nitrogen atom of the amine, enhancing its lipophilicity and potentially influencing its biological activity. This compound may exhibit various interactions due to the presence of halogen and methoxy functionalities, which can affect its reactivity and solubility in different solvents. Additionally, benzamide derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. Overall, the specific characteristics of this compound, including its molecular weight, melting point, and solubility, would be determined through experimental data and may vary based on the conditions under which they are measured.

Formula:C₉H₁₀BrNO₂

InChI:InChI=1S/C9H10BrNO2/c1-11-9(12)7-5-6(13-2)3-4-8(7)10/h3-5H,1-2H3,(H,11,12)

InChI key:InChIKey=YVOLDMLGHDJVEC-UHFFFAOYSA-N

SMILES:O=C(NC)C1=CC(OC)=CC=C1Br