CAS 17156-65-9: 1,1′-(Ethynylmethylsilylene)bis[benzene]

Description:1,1′-(Ethynylmethylsilylene)bis[benzene], with the CAS number 17156-65-9, is an organosilicon compound characterized by the presence of a silicon atom bonded to two benzene rings and an ethynylmethyl group. This compound features a unique structure that incorporates a silicon atom, which can impart distinctive chemical properties such as increased stability and reactivity compared to traditional organic compounds. The ethynylmethylsilylene moiety contributes to its potential applications in materials science and organic synthesis, particularly in the development of silicon-containing polymers and advanced materials. The presence of the benzene rings provides aromatic stability and can influence the electronic properties of the compound. Additionally, the compound may exhibit interesting photophysical properties due to the conjugated system formed by the ethynyl groups and the aromatic rings. Overall, 1,1′-(Ethynylmethylsilylene)bis[benzene] represents a fascinating example of organosilicon chemistry with potential implications in various fields, including organic electronics and nanotechnology.

Formula:C₁₅H₁₄Si

InChI:InChI=1S/C15H14Si/c1-3-16(2,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h1,4-13H,2H3

InChI key:InChIKey=XSXNZQAPLNNSCP-UHFFFAOYSA-N

SMILES:C#C[Si](C=1C=CC=CC1)(C=2C=CC=CC2)C