CAS 171869-95-7: PALMATINE CHLORIDE 95%
Description:Palmatine chloride, with the CAS number 171869-95-7, is a quaternary ammonium compound characterized by its cationic nature. It is derived from palmatine, a natural alkaloid found in various plants, and is typically presented as a white to off-white powder. This substance is soluble in water and exhibits antimicrobial properties, making it useful in various applications, including pharmaceuticals, cosmetics, and as a disinfectant. Palmatine chloride is known for its ability to interact with biological membranes, which can influence its efficacy in antimicrobial formulations. Additionally, it may have applications in research settings, particularly in studies related to cell biology and pharmacology. As with many chemical substances, handling precautions should be observed due to its potential irritant effects on skin and mucous membranes. Overall, palmatine chloride is valued for its functional properties in both industrial and research contexts.
Formula:C21H24ClNO5
InChI:InChI=1/C21H22NO4.ClH.H2O/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;;/h5-6,9-12H,7-8H2,1-4H3;1H;1H2/q+1;;/p-1
- Synonyms:
- 2,3,9,10-Tetramethoxy-5,6-Dihydroisoquino[3,2-A]Isoquinolinium Chloride Hydrate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Palmatine hydrochloride hydrate REF: 7W-GP2867CAS: 171869-95-7 | ≥ 95.0% (anhydrous basis) | 33.00 €~185.00 € | Fri 28 Mar 25 |
![]() | Palmatine chloride hydrate REF: 3D-WGA86995CAS: 171869-95-7 | Min. 95% | - - - | Discontinued product |

Palmatine hydrochloride hydrate
Ref: 7W-GP2867
25mg | 33.00 € | ||
100mg | 67.00 € | ||
250mg | 111.00 € | ||
500mg | 185.00 € |

Palmatine chloride hydrate
Ref: 3D-WGA86995
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |