CAS 17267-46-8: (2S,3R)-2-(Dimethylamino)-1,3-octadecanediol

Description:(2S,3R)-2-(Dimethylamino)-1,3-octadecanediol, with CAS number 17267-46-8, is a chiral compound characterized by its long hydrocarbon chain, which contributes to its amphiphilic nature. This substance features a dimethylamino group, which imparts basic properties and enhances its solubility in polar solvents. The presence of hydroxyl groups at the 1 and 3 positions of the octadecane backbone allows for hydrogen bonding, making it more soluble in water compared to purely hydrophobic compounds. Its stereochemistry, indicated by the (2S,3R) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. This compound is often studied for its potential applications in pharmaceuticals, surfactants, and as a biochemical agent due to its ability to interact with lipid membranes and proteins. Overall, its unique structural features make it a subject of interest in various fields, including medicinal chemistry and materials science.

Formula:C₂₀H₄₃NO₂

InChI:InChI=1S/C20H43NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h19-20,22-23H,4-18H2,1-3H3/t19-,20+/m0/s1

InChI key:InChIKey=BYBHBTCYJMUUDZ-VQTJNVASSA-N

SMILES:OCC(N(C)C)C(O)CCCCCCCCCCCCCCC

Synonyms:
(2S,3R)-2-(Dimethylamino)-1,3-octadecanediol
1,3-Octadecanediol, 2-(dimethylamino)-, [R-(R*,S*)]-
1,3-Octadecanediol, 2-(dimethylamino)-, (2S,3R)-
1,3-Octadecanediol, 2-(dimethylamino)-, D-erythro-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
N,N-dimethyl Sphinganine (d18:0) REF: TM-T36987CAS: 17267-46-8	- - -	94.00 €~394.00 €	Fri 28 Mar 25
N,N-dimethyl Sphinganine (d18:0) REF: 48-56-1401CAS: 17267-46-8	>95%	103.00 €	Mon 31 Mar 25
N,N-Dimethyl-D-erythro-dihydrosphingosine REF: 3D-SAA26746CAS: 17267-46-8	Min. 95%	- - -	Discontinued product