CAS 173053-55-9: 3-Chloro-4-(1-pyrrolidinyl)-1,2,5-thiadiazole

Description: 3-Chloro-4-(1-pyrrolidinyl)-1,2,5-thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a chlorine substituent at the 3-position and a pyrrolidine group at the 4-position, contributing to its unique chemical properties. This structure imparts potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyrrolidine moiety may enhance its lipophilicity and ability to interact with biological targets. Additionally, the chlorine atom can influence the compound's reactivity and stability. As with many heterocycles, the compound may exhibit diverse pharmacological effects, including antimicrobial or anti-inflammatory properties, although specific biological activities would require empirical investigation. The compound's molecular weight, solubility, and other physical properties would depend on its specific structure and functional groups, which are crucial for understanding its behavior in various chemical environments.

Formula: C₆H₈ClN₃S

InChI: InChI=1S/C6H8ClN3S/c7-5-6(9-11-8-5)10-3-1-2-4-10/h1-4H2

InChI key: InChIKey=LQKNJGKYVMMIPY-UHFFFAOYSA-N

SMILES: ClC1=NSN=C1N2CCCC2

Synonyms:

• 3-Chloro-4-(1-pyrrolidinyl)-1,2,5-thiadiazole
• 4-Chloro-3-(pyrrolidin-1-yl)-1,2,5-thiadiazole
• 1,2,5-Thiadiazole, 3-chloro-4-(1-pyrrolidinyl)-

3-Chloro-4-(pyrrolidin-1-yl)-1,2,5-thiadiazole

CAS: 173053-55-9

• Purity: 97%
• Molecular weight: 189.66000366210938

3-Chloro-4-(pyrrolidin-1-yl)-1,2,5-thiadiazole

CAS: 173053-55-9

Versatile small molecule scaffold

• Formula: C₆H₈ClN₃S
• Purity: Min. 95%
• Molecular weight: 189.67 g/mol