CAS 17400-77-0: P-NITROPHENYL-ALPHA-D-MALTOSIDE
Description:P-Nitrophenyl-alpha-D-maltoside is a synthetic compound commonly used as a substrate in biochemical assays, particularly in the study of glycosidases and other enzymes that hydrolyze glycosidic bonds. It features a p-nitrophenyl group, which serves as a chromogenic marker, allowing for the quantification of enzymatic activity through colorimetric changes upon hydrolysis. The compound is characterized by its maltoside structure, which consists of two glucose units linked by an alpha-glycosidic bond, making it a disaccharide derivative. P-Nitrophenyl-alpha-D-maltoside is typically soluble in water and organic solvents, facilitating its use in various laboratory settings. Its stability and reactivity make it an important tool in enzymology and carbohydrate chemistry. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, its utility in research underscores its significance in understanding enzyme mechanisms and carbohydrate metabolism.
Formula:C18H25NO13
InChI:InChI=1/C18H25NO13/c20-5-9-11(22)12(23)14(25)18(30-9)32-16-10(6-21)31-17(15(26)13(16)24)29-8-3-1-7(2-4-8)19(27)28/h1-4,9-18,20-26H,5-6H2/t9-,10-,11-,12+,13-,14-,15-,16-,17+,18-/m1/s1