CAS 174064-02-9: 5-(Triethylsilyl)-4-pentyn-1-ol
Description:5-(Triethylsilyl)-4-pentyn-1-ol is an organosilicon compound characterized by the presence of a triethylsilyl group attached to a pentyn-1-ol structure. This compound features a terminal alkyne functional group, which contributes to its reactivity, particularly in coupling reactions and as a precursor in organic synthesis. The triethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. Additionally, the presence of the hydroxyl (-OH) group provides potential for hydrogen bonding, influencing its physical properties such as boiling point and solubility. The compound is typically handled under anhydrous conditions due to the sensitivity of the alkyne to moisture. Its unique structure allows it to serve as a versatile intermediate in the synthesis of more complex molecules, particularly in the fields of pharmaceuticals and materials science. As with many organosilicon compounds, safety precautions should be observed during handling due to potential reactivity and toxicity.
Formula:C11H22OSi
InChI:InChI=1S/C11H22OSi/c1-4-13(5-2,6-3)11-9-7-8-10-12/h12H,4-8,10H2,1-3H3
InChI key:InChIKey=RDNBUIIPNLWRPB-UHFFFAOYSA-N
SMILES:OCCCC#C[Si](CC)(CC)CC
- Synonyms:
- 4-Pentyn-1-ol, 5-(triethylsilyl)-
- 4-Triethylsilyl-4-pentyn-1-ol
- 5-(Triethylsilyl)Pent-4-Yn-1-Ol
- 5-Triethylsilyl-4-Pentyn-1-Ol, 97+%
- Timtec-Bb Sbb009025
- 5-(Triethylsilyl)-4-pentyn-1-ol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Pentyn-1-ol, 5-(triethylsilyl)- REF: IN-DA001ZEZCAS: 174064-02-9 | 95% | To inquire | Thu 27 Mar 25 |
![]() | 5-(Triethylsilyl)-4-pentyn-1-ol REF: 10-S17622CAS: 174064-02-9 | - - - | - - - | Discontinued product |
![]() | 5-(Triethylsilyl)-4-pentyn-1-ol REF: 3D-ZGA06402CAS: 174064-02-9 | Min. 95% | - - - | Discontinued product |

4-Pentyn-1-ol, 5-(triethylsilyl)-
Ref: IN-DA001ZEZ
Undefined size | To inquire |

5-(Triethylsilyl)-4-pentyn-1-ol
Ref: 10-S17622
25g | Discontinued | Request information |

5-(Triethylsilyl)-4-pentyn-1-ol
Ref: 3D-ZGA06402
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |