CAS 174097-70-2: (2S,3R,3aS,6R,6aS,8R,9S,10aR,10bR)-Decahydro-2-methoxy-3,6,9-trimethyl-10aH-9,10b-epoxypyrano[4,3,2-jk][2]benzoxepin-8-ol

Description:The chemical substance with the name "(2S,3R,3aS,6R,6aS,8R,9S,10aR,10bR)-Decahydro-2-methoxy-3,6,9-trimethyl-10aH-9,10b-epoxypyrano[4,3,2-jk][2]benzoxepin-8-ol" and CAS number "174097-70-2" is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a bicyclic structure that includes a pyran and benzoxepin moiety, contributing to its potential biological activity. The presence of multiple methyl groups suggests a degree of hydrophobicity, which may influence its solubility and interaction with biological membranes. The methoxy group enhances its reactivity and may participate in various chemical reactions. Additionally, the stereocenters indicate that the compound may exhibit specific spatial configurations, which can significantly affect its pharmacological properties. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic applications. Overall, the structural complexity and functional diversity of this compound make it a subject of interest for further research in various chemical and biological contexts.

Formula:C₁₆H₂₆O₅

InChI:InChI=1S/C16H26O5/c1-8-5-6-10-9(2)13(18-4)19-14-16(10)11(8)7-12(17)15(3,20-14)21-16/h8-14,17H,5-7H2,1-4H3/t8-,9-,10+,11+,12-,13+,14-,15-,16+/m1/s1

InChI key:InChIKey=NYMSZZKRBMNKGP-HPHKUEEDSA-N

SMILES:OC1CC2C(C)CCC3C(C)C(OC)OC4OC1(OC432)C