CAS 174280-29-6: N-(3-CYANO-3-(4-(DICYANOMETHYL)PHENYL)-&

Description:N-(3-Cyano-3-(4-(dicyanomethyl)phenyl)- is a chemical compound characterized by its complex structure, which includes cyano and phenyl groups. The presence of cyano groups indicates that it may exhibit significant reactivity, particularly in nucleophilic addition reactions. This compound is likely to be a solid at room temperature, given the presence of multiple cyano groups, which can enhance intermolecular interactions. It may also possess notable electronic properties due to the conjugation between the cyano and phenyl moieties, potentially making it useful in organic electronics or as a precursor in synthetic chemistry. The dicyanomethyl group suggests that the compound could have applications in materials science, particularly in the development of dyes or pigments. Additionally, its unique structure may confer specific optical or electronic characteristics, making it a candidate for research in fields such as photonics or photovoltaics. However, detailed safety and handling information should be consulted, as compounds with cyano groups can be toxic and require careful management in laboratory settings.

Formula:C₁₇H₁₆N₄

InChI:InChI=1/C17H16N4/c1-3-21(4-2)10-9-16(11-18)14-5-7-15(8-6-14)17(12-19)13-20/h5-10H,3-4H2,1-2H3/b16-9+