CAS 17452-15-2: 1,3-Dihydro-1-(3-pyridinyl)-2H-imidazole-2-thione
Description:1,3-Dihydro-1-(3-pyridinyl)-2H-imidazole-2-thione, with the CAS number 17452-15-2, is a heterocyclic compound characterized by its imidazole ring structure, which is fused with a pyridine moiety. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom within the imidazole ring. The presence of the pyridine ring contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. The compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its chemical properties include the ability to participate in nucleophilic reactions due to the presence of the thione group, which can act as a soft nucleophile. Additionally, the compound may exhibit tautomerism, where the thione form can interconvert with a thiol form. Overall, 1,3-Dihydro-1-(3-pyridinyl)-2H-imidazole-2-thione is of interest in medicinal chemistry and may have applications in drug development.
Formula:C8H7N3S
InChI:InChI=1S/C8H7N3S/c12-8-10-4-5-11(8)7-2-1-3-9-6-7/h1-6H,(H,10,12)
InChI key:InChIKey=GUFDFGXJICAQJM-UHFFFAOYSA-N
SMILES:S=C1NC=CN1C=2C=NC=CC2
- Synonyms:
- Imidazole-2-thiol, 1-(3-pyridyl)-
- 1-Pyridin-3-yl-1H-imidazole-2-thiol
- 3-(2-Thio-1H-imidazol-1-yl)pyridine
- 1,3-Dihydro-1-(3-pyridinyl)-2H-imidazole-2-thione
- 2H-Imidazole-2-thione, 1,3-dihydro-1-(3-pyridinyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-Pyridin-3-yl-1H-imidazole-2-thiol REF: 10-F478500CAS: 17452-15-2 | - - - | 394.00 €~594.00 € | Tue 25 Mar 25 |
 | 2H-Imidazole-2-thione, 1,3-dihydro-1-(3-pyridinyl)- REF: IN-DA001ZQUCAS: 17452-15-2 | - - - | To inquire | Thu 27 Mar 25 |
 | 1-Pyridin-3-yl-1H-imidazole-2-thiol REF: 54-OR111141CAS: 17452-15-2 | - - - | 408.00 € | Fri 28 Mar 25 |
 | 1-Pyridin-3-yl-1H-imidazole-2-thiol REF: 3D-SAA45215CAS: 17452-15-2 | Min. 95% | - - - | Discontinued product |
1-Pyridin-3-yl-1H-imidazole-2-thiol
Ref: 10-F478500
| 1g | 594.00 € | ||
| 250mg | 394.00 € |
2H-Imidazole-2-thione, 1,3-dihydro-1-(3-pyridinyl)-
Ref: IN-DA001ZQU
| Undefined size | To inquire |
1-Pyridin-3-yl-1H-imidazole-2-thiol
Ref: 3D-SAA45215
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
