CAS 175135-24-7: 2-(Propylthio)-3-pyridinecarbonyl chloride

Description:2-(Propylthio)-3-pyridinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a propylthio group and a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the carbonyl chloride moiety, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, particularly in the preparation of various derivatives. The propylthio group contributes to its overall hydrophobic character, influencing its solubility in organic solvents. Additionally, this compound may exhibit biological activity, which can be of interest in pharmaceutical research. Safety precautions should be taken when handling this substance, as it may be corrosive and harmful upon exposure. Proper storage conditions are essential to maintain its stability and prevent degradation.

Formula:C₉H₁₀ClNOS

InChI:InChI=1S/C9H10ClNOS/c1-2-6-13-9-7(8(10)12)4-3-5-11-9/h3-5H,2,6H2,1H3

InChI key:InChIKey=FTEUTJYYROCUBI-UHFFFAOYSA-N

SMILES:O=C(Cl)C1=CC=CN=C1SCCC